About 2-ethynyl-1,3-benzothiazole
2-ethynyl-1,3-benzothiazole (PubChem CID 640710) has the molecular formula C9H5NS
and a molecular weight of 159.21 g/mol. Its IUPAC name is 2-ethynyl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-ethynyl-1,3-benzothiazole |
| PubChem CID | 640710 |
| Molecular Formula | C9H5NS |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.01 |
| IUPAC Name | 2-ethynyl-1,3-benzothiazole |
| SMILES | C#Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C9H5NS/c1-2-9-10-7-5-3-4-6-8(7)11-9/h1,3-6H |
| InChIKey | ZLVCPVCGNOKHRF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethynyl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethynyl-1,3-benzothiazole?
The IUPAC name of 2-ethynyl-1,3-benzothiazole (CID 640710) is 2-ethynyl-1,3-benzothiazole.
What is the SMILES notation for 2-ethynyl-1,3-benzothiazole?
The canonical SMILES for 2-ethynyl-1,3-benzothiazole is C#Cc1nc2ccccc2s1.
What is the InChIKey of 2-ethynyl-1,3-benzothiazole?
The InChIKey is ZLVCPVCGNOKHRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5NS/c1-2-9-10-7-5-3-4-6-8(7)11-9/h1,3-6H.
What are the key properties of 2-ethynyl-1,3-benzothiazole?
2-ethynyl-1,3-benzothiazole has a molecular weight of 159.21 g/mol, XLogP of 2.28, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethynyl-1,3-benzothiazole is sourced from PubChem (CID 640710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).