C27H18ClN5 — CID 6407149
4-(4-chlorophenyl)-N-(1-phenylbenzimidazol-5-yl)phthalazin-1-amine (PubChem CID 6407149) has the molecular formula C27H18ClN5 and a molecular weight of 447.93 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(1-phenylbenzimidazol-5-yl)phthalazin-1-amine.
| Compound Name | 4-(4-chlorophenyl)-N-(1-phenylbenzimidazol-5-yl)phthalazin-1-amine |
|---|---|
| PubChem CID | 6407149 |
| Molecular Formula | C27H18ClN5 |
| Molecular Weight | 447.93 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(1-phenylbenzimidazol-5-yl)phthalazin-1-amine |
| SMILES | Clc1ccc(-c2nnc(Nc3ccc4c(c3)ncn4-c3ccccc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C27H18ClN5/c28-19-12-10-18(11-13-19)26-22-8-4-5-9-23(22)27(32-31-26)30-20-14-15-25-24(16-20)29-17-33(25)21-6-2-1-3-7-21/h1-17H,(H,30,32) |
| InChIKey | YXESCPALATVLEF-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.93 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |