C6H13N3O2 — CID 6407354
(2Z)-2-hydroxyimino-N-[3-(methylamino)propyl]acetamide (PubChem CID 6407354) has the molecular formula C6H13N3O2 and a molecular weight of 159.19 g/mol. Its IUPAC name is (2Z)-2-hydroxyimino-N-[3-(methylamino)propyl]acetamide.
| Compound Name | (2Z)-2-hydroxyimino-N-[3-(methylamino)propyl]acetamide |
|---|---|
| PubChem CID | 6407354 |
| Molecular Formula | C6H13N3O2 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | (2Z)-2-hydroxyimino-N-[3-(methylamino)propyl]acetamide |
| SMILES | CNCCCNC(=O)/C=N\O |
| InChI | InChI=1S/C6H13N3O2/c1-7-3-2-4-8-6(10)5-9-11/h5,7,11H,2-4H2,1H3,(H,8,10)/b9-5- |
| InChIKey | CJCPPWFKRIQBCP-UITAMQMPSA-N |
| XLogP | -0.83 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|