C19H24N4OS — CID 6407890
(3'R,6R)-3'-methyl-3-propylsulfanylspiro[7H-[1,2,4]triazino[5,6-d][3,1]benzoxazepine-6,1'-cyclohexane] (PubChem CID 6407890) has the molecular formula C19H24N4OS and a molecular weight of 356.50 g/mol. Its IUPAC name is (3'R,6R)-3'-methyl-3-propylsulfanylspiro[7H-[1,2,4]triazino[5,6-d][3,1]benzoxazepine-6,1'-cyclohexane].
| Compound Name | (3'R,6R)-3'-methyl-3-propylsulfanylspiro[7H-[1,2,4]triazino[5,6-d][3,1]benzoxazepine-6,1'-cyclohexane] |
|---|---|
| PubChem CID | 6407890 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (3'R,6R)-3'-methyl-3-propylsulfanylspiro[7H-[1,2,4]triazino[5,6-d][3,1]benzoxazepine-6,1'-cyclohexane] |
| SMILES | CCCSc1nnc2c(n1)O[C@@]1(CCC[C@@H](C)C1)Nc1ccccc1-2 |
| InChI | InChI=1S/C19H24N4OS/c1-3-11-25-18-20-17-16(22-23-18)14-8-4-5-9-15(14)21-19(24-17)10-6-7-13(2)12-19/h4-5,8-9,13,21H,3,6-7,10-12H2,1-2H3/t13-,19-/m1/s1 |
| InChIKey | LRFBDTDMGAHIHR-BFUOFWGJSA-N |
| XLogP | 4.75 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |