About 1-ethyl-8-phenyl-3,7-dihydropurine-2,6-dione
1-ethyl-8-phenyl-3,7-dihydropurine-2,6-dione (PubChem CID 640847) has the molecular formula C13H12N4O2
and a molecular weight of 256.26 g/mol. Its IUPAC name is 1-ethyl-8-phenyl-3,7-dihydropurine-2,6-dione.
Molecular Properties
| Compound Name | 1-ethyl-8-phenyl-3,7-dihydropurine-2,6-dione |
| PubChem CID | 640847 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 1-ethyl-8-phenyl-3,7-dihydropurine-2,6-dione |
| SMILES | CCn1c(=O)[nH]c2nc(-c3ccccc3)[nH]c2c1=O |
| InChI | InChI=1S/C13H12N4O2/c1-2-17-12(18)9-11(16-13(17)19)15-10(14-9)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,14,15)(H,16,19) |
| InChIKey | CLFCOXMMCBVJJB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-8-phenyl-3,7-dihydropurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-8-phenyl-3,7-dihydropurine-2,6-dione?
The IUPAC name of 1-ethyl-8-phenyl-3,7-dihydropurine-2,6-dione (CID 640847) is 1-ethyl-8-phenyl-3,7-dihydropurine-2,6-dione.
What is the SMILES notation for 1-ethyl-8-phenyl-3,7-dihydropurine-2,6-dione?
The canonical SMILES for 1-ethyl-8-phenyl-3,7-dihydropurine-2,6-dione is CCn1c(=O)[nH]c2nc(-c3ccccc3)[nH]c2c1=O.
What is the InChIKey of 1-ethyl-8-phenyl-3,7-dihydropurine-2,6-dione?
The InChIKey is CLFCOXMMCBVJJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4O2/c1-2-17-12(18)9-11(16-13(17)19)15-10(14-9)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,14,15)(H,16,19).
What are the key properties of 1-ethyl-8-phenyl-3,7-dihydropurine-2,6-dione?
1-ethyl-8-phenyl-3,7-dihydropurine-2,6-dione has a molecular weight of 256.26 g/mol, XLogP of 1.10, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-8-phenyl-3,7-dihydropurine-2,6-dione is sourced from PubChem (CID 640847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).