About 2-methylsulfonyl-1,3,5-tri(propan-2-yl)benzene
2-methylsulfonyl-1,3,5-tri(propan-2-yl)benzene (PubChem CID 640904) has the molecular formula C16H26O2S
and a molecular weight of 282.45 g/mol. Its IUPAC name is 2-methylsulfonyl-1,3,5-tri(propan-2-yl)benzene.
Molecular Properties
| Compound Name | 2-methylsulfonyl-1,3,5-tri(propan-2-yl)benzene |
| PubChem CID | 640904 |
| Molecular Formula | C16H26O2S |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2-methylsulfonyl-1,3,5-tri(propan-2-yl)benzene |
| SMILES | CC(C)c1cc(C(C)C)c(S(C)(=O)=O)c(C(C)C)c1 |
| InChI | InChI=1S/C16H26O2S/c1-10(2)13-8-14(11(3)4)16(19(7,17)18)15(9-13)12(5)6/h8-12H,1-7H3 |
| InChIKey | FVXSGPOTUQFLOB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylsulfonyl-1,3,5-tri(propan-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfonyl-1,3,5-tri(propan-2-yl)benzene?
The IUPAC name of 2-methylsulfonyl-1,3,5-tri(propan-2-yl)benzene (CID 640904) is 2-methylsulfonyl-1,3,5-tri(propan-2-yl)benzene.
What is the SMILES notation for 2-methylsulfonyl-1,3,5-tri(propan-2-yl)benzene?
The canonical SMILES for 2-methylsulfonyl-1,3,5-tri(propan-2-yl)benzene is CC(C)c1cc(C(C)C)c(S(C)(=O)=O)c(C(C)C)c1.
What is the InChIKey of 2-methylsulfonyl-1,3,5-tri(propan-2-yl)benzene?
The InChIKey is FVXSGPOTUQFLOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O2S/c1-10(2)13-8-14(11(3)4)16(19(7,17)18)15(9-13)12(5)6/h8-12H,1-7H3.
What are the key properties of 2-methylsulfonyl-1,3,5-tri(propan-2-yl)benzene?
2-methylsulfonyl-1,3,5-tri(propan-2-yl)benzene has a molecular weight of 282.45 g/mol, XLogP of 4.46, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfonyl-1,3,5-tri(propan-2-yl)benzene is sourced from PubChem (CID 640904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).