About 3-(2-phenoxyethylsulfanyl)-5,6-diphenyl-1,2,4-triazine
3-(2-phenoxyethylsulfanyl)-5,6-diphenyl-1,2,4-triazine (PubChem CID 6409075) has the molecular formula C23H19N3OS
and a molecular weight of 385.49 g/mol. Its IUPAC name is 3-(2-phenoxyethylsulfanyl)-5,6-diphenyl-1,2,4-triazine.
Molecular Properties
| Compound Name | 3-(2-phenoxyethylsulfanyl)-5,6-diphenyl-1,2,4-triazine |
| PubChem CID | 6409075 |
| Molecular Formula | C23H19N3OS |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 3-(2-phenoxyethylsulfanyl)-5,6-diphenyl-1,2,4-triazine |
| SMILES | c1ccc(OCCSc2nnc(-c3ccccc3)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H19N3OS/c1-4-10-18(11-5-1)21-22(19-12-6-2-7-13-19)25-26-23(24-21)28-17-16-27-20-14-8-3-9-15-20/h1-15H,16-17H2 |
| InChIKey | DYKNPWFBRIBXKR-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-phenoxyethylsulfanyl)-5,6-diphenyl-1,2,4-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-phenoxyethylsulfanyl)-5,6-diphenyl-1,2,4-triazine?
The IUPAC name of 3-(2-phenoxyethylsulfanyl)-5,6-diphenyl-1,2,4-triazine (CID 6409075) is 3-(2-phenoxyethylsulfanyl)-5,6-diphenyl-1,2,4-triazine.
What is the SMILES notation for 3-(2-phenoxyethylsulfanyl)-5,6-diphenyl-1,2,4-triazine?
The canonical SMILES for 3-(2-phenoxyethylsulfanyl)-5,6-diphenyl-1,2,4-triazine is c1ccc(OCCSc2nnc(-c3ccccc3)c(-c3ccccc3)n2)cc1.
What is the InChIKey of 3-(2-phenoxyethylsulfanyl)-5,6-diphenyl-1,2,4-triazine?
The InChIKey is DYKNPWFBRIBXKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19N3OS/c1-4-10-18(11-5-1)21-22(19-12-6-2-7-13-19)25-26-23(24-21)28-17-16-27-20-14-8-3-9-15-20/h1-15H,16-17H2.
What are the key properties of 3-(2-phenoxyethylsulfanyl)-5,6-diphenyl-1,2,4-triazine?
3-(2-phenoxyethylsulfanyl)-5,6-diphenyl-1,2,4-triazine has a molecular weight of 385.49 g/mol, XLogP of 5.38, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-phenoxyethylsulfanyl)-5,6-diphenyl-1,2,4-triazine is sourced from PubChem (CID 6409075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).