C20H20N4O2S — CID 6409400
2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]-N-(2-methoxyethyl)acetamide (PubChem CID 6409400) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is 2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 6409400 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CSc1nnc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H20N4O2S/c1-26-13-12-21-17(25)14-27-20-22-18(15-8-4-2-5-9-15)19(23-24-20)16-10-6-3-7-11-16/h2-11H,12-14H2,1H3,(H,21,25) |
| InChIKey | LLUOSUGZUXDFMP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|