C17H16N4O — CID 6409502
2-[(3,6-diphenyl-1,2,4-triazin-5-yl)amino]ethanol (PubChem CID 6409502) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-[(3,6-diphenyl-1,2,4-triazin-5-yl)amino]ethanol.
| Compound Name | 2-[(3,6-diphenyl-1,2,4-triazin-5-yl)amino]ethanol |
|---|---|
| PubChem CID | 6409502 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-[(3,6-diphenyl-1,2,4-triazin-5-yl)amino]ethanol |
| SMILES | OCCNc1nc(-c2ccccc2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C17H16N4O/c22-12-11-18-17-15(13-7-3-1-4-8-13)20-21-16(19-17)14-9-5-2-6-10-14/h1-10,22H,11-12H2,(H,18,19,21) |
| InChIKey | AYYZOOXZBZEHRQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |