C18H17ClN4O — CID 6409514
3-[[3-(4-chlorophenyl)-6-phenyl-1,2,4-triazin-5-yl]amino]propan-1-ol (PubChem CID 6409514) has the molecular formula C18H17ClN4O and a molecular weight of 340.81 g/mol. Its IUPAC name is 3-[[3-(4-chlorophenyl)-6-phenyl-1,2,4-triazin-5-yl]amino]propan-1-ol.
| Compound Name | 3-[[3-(4-chlorophenyl)-6-phenyl-1,2,4-triazin-5-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 6409514 |
| Molecular Formula | C18H17ClN4O |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 3-[[3-(4-chlorophenyl)-6-phenyl-1,2,4-triazin-5-yl]amino]propan-1-ol |
| SMILES | OCCCNc1nc(-c2ccc(Cl)cc2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C18H17ClN4O/c19-15-9-7-14(8-10-15)17-21-18(20-11-4-12-24)16(22-23-17)13-5-2-1-3-6-13/h1-3,5-10,24H,4,11-12H2,(H,20,21,23) |
| InChIKey | GUISEDJEYODVAX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|