About 1-fluoroisoquinoline
1-fluoroisoquinoline (PubChem CID 640962) has the molecular formula C9H6FN
and a molecular weight of 147.15 g/mol. Its IUPAC name is 1-fluoroisoquinoline.
Molecular Properties
| Compound Name | 1-fluoroisoquinoline |
| PubChem CID | 640962 |
| Molecular Formula | C9H6FN |
| Molecular Weight | 147.15 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | 1-fluoroisoquinoline |
| SMILES | Fc1nccc2ccccc12 |
| InChI | InChI=1S/C9H6FN/c10-9-8-4-2-1-3-7(8)5-6-11-9/h1-6H |
| InChIKey | YYMRKWBKEKCKHM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.15 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoroisoquinoline?
The IUPAC name of 1-fluoroisoquinoline (CID 640962) is 1-fluoroisoquinoline.
What is the SMILES notation for 1-fluoroisoquinoline?
The canonical SMILES for 1-fluoroisoquinoline is Fc1nccc2ccccc12.
What is the InChIKey of 1-fluoroisoquinoline?
The InChIKey is YYMRKWBKEKCKHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6FN/c10-9-8-4-2-1-3-7(8)5-6-11-9/h1-6H.
What are the key properties of 1-fluoroisoquinoline?
1-fluoroisoquinoline has a molecular weight of 147.15 g/mol, XLogP of 2.37, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoroisoquinoline is sourced from PubChem (CID 640962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).