C19H18N4 — CID 6409931
5,6-diphenyl-3-pyrrolidin-1-yl-1,2,4-triazine (PubChem CID 6409931) has the molecular formula C19H18N4 and a molecular weight of 302.38 g/mol. Its IUPAC name is 5,6-diphenyl-3-pyrrolidin-1-yl-1,2,4-triazine.
| Compound Name | 5,6-diphenyl-3-pyrrolidin-1-yl-1,2,4-triazine |
|---|---|
| PubChem CID | 6409931 |
| Molecular Formula | C19H18N4 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 5,6-diphenyl-3-pyrrolidin-1-yl-1,2,4-triazine |
| SMILES | c1ccc(-c2nnc(N3CCCC3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H18N4/c1-3-9-15(10-4-1)17-18(16-11-5-2-6-12-16)21-22-19(20-17)23-13-7-8-14-23/h1-6,9-12H,7-8,13-14H2 |
| InChIKey | LEDUPPZTDFQNQU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |