About (2S,3R)-3-aminobutan-2-ol
(2S,3R)-3-aminobutan-2-ol (PubChem CID 640996) has the molecular formula C4H11NO
and a molecular weight of 89.14 g/mol. Its IUPAC name is (2S,3R)-3-aminobutan-2-ol.
Molecular Properties
| Compound Name | (2S,3R)-3-aminobutan-2-ol |
| PubChem CID | 640996 |
| Molecular Formula | C4H11NO |
| Molecular Weight | 89.14 g/mol |
| Exact Mass | 89.08 |
| IUPAC Name | (2S,3R)-3-aminobutan-2-ol |
| SMILES | C[C@H](O)[C@@H](C)N |
| InChI | InChI=1S/C4H11NO/c1-3(5)4(2)6/h3-4,6H,5H2,1-2H3/t3-,4+/m1/s1 |
| InChIKey | FERWBXLFSBWTDE-DMTCNVIQSA-N |
| XLogP | -0.29 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 89.14 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,3R)-3-aminobutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-3-aminobutan-2-ol?
The IUPAC name of (2S,3R)-3-aminobutan-2-ol (CID 640996) is (2S,3R)-3-aminobutan-2-ol.
What is the SMILES notation for (2S,3R)-3-aminobutan-2-ol?
The canonical SMILES for (2S,3R)-3-aminobutan-2-ol is C[C@H](O)[C@@H](C)N.
What is the InChIKey of (2S,3R)-3-aminobutan-2-ol?
The InChIKey is FERWBXLFSBWTDE-DMTCNVIQSA-N. The full InChI is InChI=1S/C4H11NO/c1-3(5)4(2)6/h3-4,6H,5H2,1-2H3/t3-,4+/m1/s1.
What are the key properties of (2S,3R)-3-aminobutan-2-ol?
(2S,3R)-3-aminobutan-2-ol has a molecular weight of 89.14 g/mol, XLogP of -0.29, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-3-aminobutan-2-ol is sourced from PubChem (CID 640996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).