C10H7N5 — CID 6410405
[1,2,4]triazino[5,6-c]quinolin-3-amine (PubChem CID 6410405) has the molecular formula C10H7N5 and a molecular weight of 197.20 g/mol. Its IUPAC name is [1,2,4]triazino[5,6-c]quinolin-3-amine.
| Compound Name | [1,2,4]triazino[5,6-c]quinolin-3-amine |
|---|---|
| PubChem CID | 6410405 |
| Molecular Formula | C10H7N5 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | [1,2,4]triazino[5,6-c]quinolin-3-amine |
| SMILES | Nc1nnc2c(cnc3ccccc32)n1 |
| InChI | InChI=1S/C10H7N5/c11-10-13-8-5-12-7-4-2-1-3-6(7)9(8)14-15-10/h1-5H,(H2,11,13,15) |
| InChIKey | HPTDUGRASPFLEE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|