C16H20N6O — CID 6410410
5,8-dimethyl-3-(4-methyl-4-oxidopiperazin-4-ium-1-yl)-[1,2,4]triazino[5,6-b]indole (PubChem CID 6410410) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is 5,8-dimethyl-3-(4-methyl-4-oxidopiperazin-4-ium-1-yl)-[1,2,4]triazino[5,6-b]indole.
| Compound Name | 5,8-dimethyl-3-(4-methyl-4-oxidopiperazin-4-ium-1-yl)-[1,2,4]triazino[5,6-b]indole |
|---|---|
| PubChem CID | 6410410 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 5,8-dimethyl-3-(4-methyl-4-oxidopiperazin-4-ium-1-yl)-[1,2,4]triazino[5,6-b]indole |
| SMILES | Cc1ccc2c(c1)c1nnc(N3CC[N+](C)([O-])CC3)nc1n2C |
| InChI | InChI=1S/C16H20N6O/c1-11-4-5-13-12(10-11)14-15(20(13)2)17-16(19-18-14)21-6-8-22(3,23)9-7-21/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | RQUNFELWQKUNJR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|