C14H20Cl2N4 — CID 6410650
N'-(4-methyl-6-phenylpyridazin-3-yl)propane-1,3-diamine;dihydrochloride (PubChem CID 6410650) has the molecular formula C14H20Cl2N4 and a molecular weight of 315.25 g/mol. Its IUPAC name is N'-(4-methyl-6-phenylpyridazin-3-yl)propane-1,3-diamine;dihydrochloride.
| Compound Name | N'-(4-methyl-6-phenylpyridazin-3-yl)propane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 6410650 |
| Molecular Formula | C14H20Cl2N4 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N'-(4-methyl-6-phenylpyridazin-3-yl)propane-1,3-diamine;dihydrochloride |
| SMILES | Cc1cc(-c2ccccc2)nnc1NCCCN.Cl.Cl |
| InChI | InChI=1S/C14H18N4.2ClH/c1-11-10-13(12-6-3-2-4-7-12)17-18-14(11)16-9-5-8-15;;/h2-4,6-7,10H,5,8-9,15H2,1H3,(H,16,18);2*1H |
| InChIKey | YKRYWHZLNMDTRV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|