About N'-(4-phenylpyridazin-3-yl)ethane-1,2-diamine
N'-(4-phenylpyridazin-3-yl)ethane-1,2-diamine (PubChem CID 6410655) has the molecular formula C12H14N4
and a molecular weight of 214.27 g/mol. Its IUPAC name is N'-(4-phenylpyridazin-3-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(4-phenylpyridazin-3-yl)ethane-1,2-diamine |
| PubChem CID | 6410655 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | N'-(4-phenylpyridazin-3-yl)ethane-1,2-diamine |
| SMILES | NCCNc1nnccc1-c1ccccc1 |
| InChI | InChI=1S/C12H14N4/c13-7-9-14-12-11(6-8-15-16-12)10-4-2-1-3-5-10/h1-6,8H,7,9,13H2,(H,14,16) |
| InChIKey | DEJHNWVBOVPFCD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(4-phenylpyridazin-3-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-phenylpyridazin-3-yl)ethane-1,2-diamine?
The IUPAC name of N'-(4-phenylpyridazin-3-yl)ethane-1,2-diamine (CID 6410655) is N'-(4-phenylpyridazin-3-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-(4-phenylpyridazin-3-yl)ethane-1,2-diamine?
The canonical SMILES for N'-(4-phenylpyridazin-3-yl)ethane-1,2-diamine is NCCNc1nnccc1-c1ccccc1.
What is the InChIKey of N'-(4-phenylpyridazin-3-yl)ethane-1,2-diamine?
The InChIKey is DEJHNWVBOVPFCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4/c13-7-9-14-12-11(6-8-15-16-12)10-4-2-1-3-5-10/h1-6,8H,7,9,13H2,(H,14,16).
What are the key properties of N'-(4-phenylpyridazin-3-yl)ethane-1,2-diamine?
N'-(4-phenylpyridazin-3-yl)ethane-1,2-diamine has a molecular weight of 214.27 g/mol, XLogP of 1.51, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-phenylpyridazin-3-yl)ethane-1,2-diamine is sourced from PubChem (CID 6410655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).