About N-methyl-N'-(4-methyl-6-phenylpyridazin-3-yl)ethane-1,2-diamine
N-methyl-N'-(4-methyl-6-phenylpyridazin-3-yl)ethane-1,2-diamine (PubChem CID 6410670) has the molecular formula C14H18N4
and a molecular weight of 242.33 g/mol. Its IUPAC name is N-methyl-N'-(4-methyl-6-phenylpyridazin-3-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-methyl-N'-(4-methyl-6-phenylpyridazin-3-yl)ethane-1,2-diamine |
| PubChem CID | 6410670 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | N-methyl-N'-(4-methyl-6-phenylpyridazin-3-yl)ethane-1,2-diamine |
| SMILES | CNCCNc1nnc(-c2ccccc2)cc1C |
| InChI | InChI=1S/C14H18N4/c1-11-10-13(12-6-4-3-5-7-12)17-18-14(11)16-9-8-15-2/h3-7,10,15H,8-9H2,1-2H3,(H,16,18) |
| InChIKey | FAXNSIHPVPBXIA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N'-(4-methyl-6-phenylpyridazin-3-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N'-(4-methyl-6-phenylpyridazin-3-yl)ethane-1,2-diamine?
The IUPAC name of N-methyl-N'-(4-methyl-6-phenylpyridazin-3-yl)ethane-1,2-diamine (CID 6410670) is N-methyl-N'-(4-methyl-6-phenylpyridazin-3-yl)ethane-1,2-diamine.
What is the SMILES notation for N-methyl-N'-(4-methyl-6-phenylpyridazin-3-yl)ethane-1,2-diamine?
The canonical SMILES for N-methyl-N'-(4-methyl-6-phenylpyridazin-3-yl)ethane-1,2-diamine is CNCCNc1nnc(-c2ccccc2)cc1C.
What is the InChIKey of N-methyl-N'-(4-methyl-6-phenylpyridazin-3-yl)ethane-1,2-diamine?
The InChIKey is FAXNSIHPVPBXIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4/c1-11-10-13(12-6-4-3-5-7-12)17-18-14(11)16-9-8-15-2/h3-7,10,15H,8-9H2,1-2H3,(H,16,18).
What are the key properties of N-methyl-N'-(4-methyl-6-phenylpyridazin-3-yl)ethane-1,2-diamine?
N-methyl-N'-(4-methyl-6-phenylpyridazin-3-yl)ethane-1,2-diamine has a molecular weight of 242.33 g/mol, XLogP of 2.08, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N'-(4-methyl-6-phenylpyridazin-3-yl)ethane-1,2-diamine is sourced from PubChem (CID 6410670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).