About N-(4-methyl-6-phenylpyridazin-3-yl)-N',N'-dipropylethane-1,2-diamine
N-(4-methyl-6-phenylpyridazin-3-yl)-N',N'-dipropylethane-1,2-diamine (PubChem CID 6410809) has the molecular formula C19H28N4
and a molecular weight of 312.46 g/mol. Its IUPAC name is N-(4-methyl-6-phenylpyridazin-3-yl)-N',N'-dipropylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(4-methyl-6-phenylpyridazin-3-yl)-N',N'-dipropylethane-1,2-diamine |
| PubChem CID | 6410809 |
| Molecular Formula | C19H28N4 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | N-(4-methyl-6-phenylpyridazin-3-yl)-N',N'-dipropylethane-1,2-diamine |
| SMILES | CCCN(CCC)CCNc1nnc(-c2ccccc2)cc1C |
| InChI | InChI=1S/C19H28N4/c1-4-12-23(13-5-2)14-11-20-19-16(3)15-18(21-22-19)17-9-7-6-8-10-17/h6-10,15H,4-5,11-14H2,1-3H3,(H,20,22) |
| InChIKey | MSAMMXWFDDEMAO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-methyl-6-phenylpyridazin-3-yl)-N',N'-dipropylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methyl-6-phenylpyridazin-3-yl)-N',N'-dipropylethane-1,2-diamine?
The IUPAC name of N-(4-methyl-6-phenylpyridazin-3-yl)-N',N'-dipropylethane-1,2-diamine (CID 6410809) is N-(4-methyl-6-phenylpyridazin-3-yl)-N',N'-dipropylethane-1,2-diamine.
What is the SMILES notation for N-(4-methyl-6-phenylpyridazin-3-yl)-N',N'-dipropylethane-1,2-diamine?
The canonical SMILES for N-(4-methyl-6-phenylpyridazin-3-yl)-N',N'-dipropylethane-1,2-diamine is CCCN(CCC)CCNc1nnc(-c2ccccc2)cc1C.
What is the InChIKey of N-(4-methyl-6-phenylpyridazin-3-yl)-N',N'-dipropylethane-1,2-diamine?
The InChIKey is MSAMMXWFDDEMAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N4/c1-4-12-23(13-5-2)14-11-20-19-16(3)15-18(21-22-19)17-9-7-6-8-10-17/h6-10,15H,4-5,11-14H2,1-3H3,(H,20,22).
What are the key properties of N-(4-methyl-6-phenylpyridazin-3-yl)-N',N'-dipropylethane-1,2-diamine?
N-(4-methyl-6-phenylpyridazin-3-yl)-N',N'-dipropylethane-1,2-diamine has a molecular weight of 312.46 g/mol, XLogP of 3.99, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methyl-6-phenylpyridazin-3-yl)-N',N'-dipropylethane-1,2-diamine is sourced from PubChem (CID 6410809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).