C21H23ClN4 — CID 6410855
N-[6-(4-chlorophenyl)-4-phenylpyridazin-3-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 6410855) has the molecular formula C21H23ClN4 and a molecular weight of 366.90 g/mol. Its IUPAC name is N-[6-(4-chlorophenyl)-4-phenylpyridazin-3-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[6-(4-chlorophenyl)-4-phenylpyridazin-3-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 6410855 |
| Molecular Formula | C21H23ClN4 |
| Molecular Weight | 366.90 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N-[6-(4-chlorophenyl)-4-phenylpyridazin-3-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1nnc(-c2ccc(Cl)cc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C21H23ClN4/c1-26(2)14-6-13-23-21-19(16-7-4-3-5-8-16)15-20(24-25-21)17-9-11-18(22)12-10-17/h3-5,7-12,15H,6,13-14H2,1-2H3,(H,23,25) |
| InChIKey | OFLQCPASFULKPO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.90 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|