C20H13Cl2N5O — CID 6410895
N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-5-phenyl-1,2,4-triazin-3-amine (PubChem CID 6410895) has the molecular formula C20H13Cl2N5O and a molecular weight of 410.26 g/mol. Its IUPAC name is N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-5-phenyl-1,2,4-triazin-3-amine.
| Compound Name | N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-5-phenyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 6410895 |
| Molecular Formula | C20H13Cl2N5O |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-5-phenyl-1,2,4-triazin-3-amine |
| SMILES | Clc1ccc(-c2ccc(/C=N\Nc3nncc(-c4ccccc4)n3)o2)c(Cl)c1 |
| InChI | InChI=1S/C20H13Cl2N5O/c21-14-6-8-16(17(22)10-14)19-9-7-15(28-19)11-23-26-20-25-18(12-24-27-20)13-4-2-1-3-5-13/h1-12H,(H,25,26,27)/b23-11- |
| InChIKey | PMWKJCOFVTXZEM-KSEXSDGBSA-N |
| XLogP | 5.55 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|