C7H6Cl2O2 — CID 641120
(1S,2R,4S,5R)-2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 641120) has the molecular formula C7H6Cl2O2 and a molecular weight of 193.03 g/mol. Its IUPAC name is (1S,2R,4S,5R)-2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1S,2R,4S,5R)-2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 641120 |
| Molecular Formula | C7H6Cl2O2 |
| Molecular Weight | 193.03 g/mol |
| Exact Mass | 191.97 |
| IUPAC Name | (1S,2R,4S,5R)-2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | O=C1[C@@H](Cl)[C@H]2C=C[C@H](O2)[C@H]1Cl |
| InChI | InChI=1S/C7H6Cl2O2/c8-5-3-1-2-4(11-3)6(9)7(5)10/h1-6H/t3-,4+,5+,6- |
| InChIKey | WTVPZDGBOGCTJF-GUCUJZIJSA-N |
| XLogP | 1.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.03 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|