About pyridine-4-sulfinate
pyridine-4-sulfinate (PubChem CID 6411641) has the molecular formula C5H4NO2S-
and a molecular weight of 142.16 g/mol. Its IUPAC name is pyridine-4-sulfinate.
Molecular Properties
| Compound Name | pyridine-4-sulfinate |
| PubChem CID | 6411641 |
| Molecular Formula | C5H4NO2S- |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.00 |
| IUPAC Name | pyridine-4-sulfinate |
| SMILES | O=S([O-])c1ccncc1 |
| InChI | InChI=1S/C5H5NO2S/c7-9(8)5-1-3-6-4-2-5/h1-4H,(H,7,8)/p-1 |
| InChIKey | TZHUQQDCJYTNDZ-UHFFFAOYSA-M |
| XLogP | 0.32 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze pyridine-4-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine-4-sulfinate?
The IUPAC name of pyridine-4-sulfinate (CID 6411641) is pyridine-4-sulfinate.
What is the SMILES notation for pyridine-4-sulfinate?
The canonical SMILES for pyridine-4-sulfinate is O=S([O-])c1ccncc1.
What is the InChIKey of pyridine-4-sulfinate?
The InChIKey is TZHUQQDCJYTNDZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H5NO2S/c7-9(8)5-1-3-6-4-2-5/h1-4H,(H,7,8)/p-1.
What are the key properties of pyridine-4-sulfinate?
pyridine-4-sulfinate has a molecular weight of 142.16 g/mol, XLogP of 0.32, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-4-sulfinate is sourced from PubChem (CID 6411641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).