About 5-oxo-1H-triazolo[1,5-a]quinazoline-3-carboxamide
5-oxo-1H-triazolo[1,5-a]quinazoline-3-carboxamide (PubChem CID 6412019) has the molecular formula C10H7N5O2
and a molecular weight of 229.20 g/mol. Its IUPAC name is 5-oxo-1H-triazolo[1,5-a]quinazoline-3-carboxamide.
Molecular Properties
| Compound Name | 5-oxo-1H-triazolo[1,5-a]quinazoline-3-carboxamide |
| PubChem CID | 6412019 |
| Molecular Formula | C10H7N5O2 |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 5-oxo-1H-triazolo[1,5-a]quinazoline-3-carboxamide |
| SMILES | NC(=O)c1n[nH]n2c1nc(=O)c1ccccc12 |
| InChI | InChI=1S/C10H7N5O2/c11-8(16)7-9-12-10(17)5-3-1-2-4-6(5)15(9)14-13-7/h1-4,14H,(H2,11,16) |
| InChIKey | XAJBECXLYJGSOC-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-oxo-1H-triazolo[1,5-a]quinazoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-1H-triazolo[1,5-a]quinazoline-3-carboxamide?
The IUPAC name of 5-oxo-1H-triazolo[1,5-a]quinazoline-3-carboxamide (CID 6412019) is 5-oxo-1H-triazolo[1,5-a]quinazoline-3-carboxamide.
What is the SMILES notation for 5-oxo-1H-triazolo[1,5-a]quinazoline-3-carboxamide?
The canonical SMILES for 5-oxo-1H-triazolo[1,5-a]quinazoline-3-carboxamide is NC(=O)c1n[nH]n2c1nc(=O)c1ccccc12.
What is the InChIKey of 5-oxo-1H-triazolo[1,5-a]quinazoline-3-carboxamide?
The InChIKey is XAJBECXLYJGSOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N5O2/c11-8(16)7-9-12-10(17)5-3-1-2-4-6(5)15(9)14-13-7/h1-4,14H,(H2,11,16).
What are the key properties of 5-oxo-1H-triazolo[1,5-a]quinazoline-3-carboxamide?
5-oxo-1H-triazolo[1,5-a]quinazoline-3-carboxamide has a molecular weight of 229.20 g/mol, XLogP of -0.33, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-1H-triazolo[1,5-a]quinazoline-3-carboxamide is sourced from PubChem (CID 6412019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).