About 1-N,4-N-bis(6-methyl-2-pyridinyl)phthalazine-1,4-diamine
1-N,4-N-bis(6-methyl-2-pyridinyl)phthalazine-1,4-diamine (PubChem CID 6412069) has the molecular formula C20H18N6
and a molecular weight of 342.41 g/mol. Its IUPAC name is 1-N,4-N-bis(6-methyl-2-pyridinyl)phthalazine-1,4-diamine.
Molecular Properties
| Compound Name | 1-N,4-N-bis(6-methyl-2-pyridinyl)phthalazine-1,4-diamine |
| PubChem CID | 6412069 |
| Molecular Formula | C20H18N6 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1-N,4-N-bis(6-methyl-2-pyridinyl)phthalazine-1,4-diamine |
| SMILES | Cc1cccc(Nc2nnc(Nc3cccc(C)n3)c3ccccc23)n1 |
| InChI | InChI=1S/C20H18N6/c1-13-7-5-11-17(21-13)23-19-15-9-3-4-10-16(15)20(26-25-19)24-18-12-6-8-14(2)22-18/h3-12H,1-2H3,(H,21,23,25)(H,22,24,26) |
| InChIKey | KARCEWFFYYMJRG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-N,4-N-bis(6-methyl-2-pyridinyl)phthalazine-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,4-N-bis(6-methyl-2-pyridinyl)phthalazine-1,4-diamine?
The IUPAC name of 1-N,4-N-bis(6-methyl-2-pyridinyl)phthalazine-1,4-diamine (CID 6412069) is 1-N,4-N-bis(6-methyl-2-pyridinyl)phthalazine-1,4-diamine.
What is the SMILES notation for 1-N,4-N-bis(6-methyl-2-pyridinyl)phthalazine-1,4-diamine?
The canonical SMILES for 1-N,4-N-bis(6-methyl-2-pyridinyl)phthalazine-1,4-diamine is Cc1cccc(Nc2nnc(Nc3cccc(C)n3)c3ccccc23)n1.
What is the InChIKey of 1-N,4-N-bis(6-methyl-2-pyridinyl)phthalazine-1,4-diamine?
The InChIKey is KARCEWFFYYMJRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N6/c1-13-7-5-11-17(21-13)23-19-15-9-3-4-10-16(15)20(26-25-19)24-18-12-6-8-14(2)22-18/h3-12H,1-2H3,(H,21,23,25)(H,22,24,26).
What are the key properties of 1-N,4-N-bis(6-methyl-2-pyridinyl)phthalazine-1,4-diamine?
1-N,4-N-bis(6-methyl-2-pyridinyl)phthalazine-1,4-diamine has a molecular weight of 342.41 g/mol, XLogP of 4.52, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,4-N-bis(6-methyl-2-pyridinyl)phthalazine-1,4-diamine is sourced from PubChem (CID 6412069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).