About (2S)-2,3-dibromopropan-1-ol
(2S)-2,3-dibromopropan-1-ol (PubChem CID 641235) has the molecular formula C3H6Br2O
and a molecular weight of 217.89 g/mol. Its IUPAC name is (2S)-2,3-dibromopropan-1-ol.
Molecular Properties
| Compound Name | (2S)-2,3-dibromopropan-1-ol |
| PubChem CID | 641235 |
| Molecular Formula | C3H6Br2O |
| Molecular Weight | 217.89 g/mol |
| Exact Mass | 215.88 |
| IUPAC Name | (2S)-2,3-dibromopropan-1-ol |
| SMILES | OC[C@H](Br)CBr |
| InChI | InChI=1S/C3H6Br2O/c4-1-3(5)2-6/h3,6H,1-2H2/t3-/m1/s1 |
| InChIKey | QWVCIORZLNBIIC-GSVOUGTGSA-N |
| XLogP | 1.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.89 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2,3-dibromopropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,3-dibromopropan-1-ol?
The IUPAC name of (2S)-2,3-dibromopropan-1-ol (CID 641235) is (2S)-2,3-dibromopropan-1-ol.
What is the SMILES notation for (2S)-2,3-dibromopropan-1-ol?
The canonical SMILES for (2S)-2,3-dibromopropan-1-ol is OC[C@H](Br)CBr.
What is the InChIKey of (2S)-2,3-dibromopropan-1-ol?
The InChIKey is QWVCIORZLNBIIC-GSVOUGTGSA-N. The full InChI is InChI=1S/C3H6Br2O/c4-1-3(5)2-6/h3,6H,1-2H2/t3-/m1/s1.
What are the key properties of (2S)-2,3-dibromopropan-1-ol?
(2S)-2,3-dibromopropan-1-ol has a molecular weight of 217.89 g/mol, XLogP of 1.14, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,3-dibromopropan-1-ol is sourced from PubChem (CID 641235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).