C9H5N4S- — CID 6412479
5H-[1,2,4]triazino[5,6-b]indole-3-thiolate (PubChem CID 6412479) has the molecular formula C9H5N4S- and a molecular weight of 201.23 g/mol. Its IUPAC name is 5H-[1,2,4]triazino[5,6-b]indole-3-thiolate.
| Compound Name | 5H-[1,2,4]triazino[5,6-b]indole-3-thiolate |
|---|---|
| PubChem CID | 6412479 |
| Molecular Formula | C9H5N4S- |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | 5H-[1,2,4]triazino[5,6-b]indole-3-thiolate |
| SMILES | [S-]c1nnc2c(n1)[nH]c1ccccc12 |
| InChI | InChI=1S/C9H6N4S/c14-9-11-8-7(12-13-9)5-3-1-2-4-6(5)10-8/h1-4H,(H2,10,11,13,14)/p-1 |
| InChIKey | RPEJKVRRTJDBSN-UHFFFAOYSA-M |
| XLogP | 1.41 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|