C20H18IN5OS — CID 6413558
N-(4-iodophenyl)-2-[(5-propan-2-yl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetamide (PubChem CID 6413558) has the molecular formula C20H18IN5OS and a molecular weight of 503.37 g/mol. Its IUPAC name is N-(4-iodophenyl)-2-[(5-propan-2-yl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(4-iodophenyl)-2-[(5-propan-2-yl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 6413558 |
| Molecular Formula | C20H18IN5OS |
| Molecular Weight | 503.37 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | N-(4-iodophenyl)-2-[(5-propan-2-yl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetamide |
| SMILES | CC(C)n1c2ccccc2c2nnc(SCC(=O)Nc3ccc(I)cc3)nc21 |
| InChI | InChI=1S/C20H18IN5OS/c1-12(2)26-16-6-4-3-5-15(16)18-19(26)23-20(25-24-18)28-11-17(27)22-14-9-7-13(21)8-10-14/h3-10,12H,11H2,1-2H3,(H,22,27) |
| InChIKey | OHQWRVSASFYIJO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.37 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|