C13H9Cl2N5O3 — CID 6413661
3-(3,4-dichlorophenyl)-6,8-dimethyl-4-oxidopyrimido[5,4-e][1,2,4]triazin-4-ium-5,7-dione (PubChem CID 6413661) has the molecular formula C13H9Cl2N5O3 and a molecular weight of 354.15 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-6,8-dimethyl-4-oxidopyrimido[5,4-e][1,2,4]triazin-4-ium-5,7-dione.
| Compound Name | 3-(3,4-dichlorophenyl)-6,8-dimethyl-4-oxidopyrimido[5,4-e][1,2,4]triazin-4-ium-5,7-dione |
|---|---|
| PubChem CID | 6413661 |
| Molecular Formula | C13H9Cl2N5O3 |
| Molecular Weight | 354.15 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-6,8-dimethyl-4-oxidopyrimido[5,4-e][1,2,4]triazin-4-ium-5,7-dione |
| SMILES | Cn1c(=O)c2c(nnc(-c3ccc(Cl)c(Cl)c3)[n+]2[O-])n(C)c1=O |
| InChI | InChI=1S/C13H9Cl2N5O3/c1-18-11-9(12(21)19(2)13(18)22)20(23)10(16-17-11)6-3-4-7(14)8(15)5-6/h3-5H,1-2H3 |
| InChIKey | XYTIMPWPMYJLAI-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.15 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|