About (2E)-2-hydroxyimino-3,4-dihydronaphthalen-1-one
(2E)-2-hydroxyimino-3,4-dihydronaphthalen-1-one (PubChem CID 6413926) has the molecular formula C10H9NO2
and a molecular weight of 175.19 g/mol. Its IUPAC name is (2E)-2-hydroxyimino-3,4-dihydronaphthalen-1-one.
Molecular Properties
| Compound Name | (2E)-2-hydroxyimino-3,4-dihydronaphthalen-1-one |
| PubChem CID | 6413926 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | (2E)-2-hydroxyimino-3,4-dihydronaphthalen-1-one |
| SMILES | O=C1/C(=N/O)CCc2ccccc21 |
| InChI | InChI=1S/C10H9NO2/c12-10-8-4-2-1-3-7(8)5-6-9(10)11-13/h1-4,13H,5-6H2/b11-9+ |
| InChIKey | CMBOOGVJHNRHQC-PKNBQFBNSA-N |
| XLogP | 1.65 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-hydroxyimino-3,4-dihydronaphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-hydroxyimino-3,4-dihydronaphthalen-1-one?
The IUPAC name of (2E)-2-hydroxyimino-3,4-dihydronaphthalen-1-one (CID 6413926) is (2E)-2-hydroxyimino-3,4-dihydronaphthalen-1-one.
What is the SMILES notation for (2E)-2-hydroxyimino-3,4-dihydronaphthalen-1-one?
The canonical SMILES for (2E)-2-hydroxyimino-3,4-dihydronaphthalen-1-one is O=C1/C(=N/O)CCc2ccccc21.
What is the InChIKey of (2E)-2-hydroxyimino-3,4-dihydronaphthalen-1-one?
The InChIKey is CMBOOGVJHNRHQC-PKNBQFBNSA-N. The full InChI is InChI=1S/C10H9NO2/c12-10-8-4-2-1-3-7(8)5-6-9(10)11-13/h1-4,13H,5-6H2/b11-9+.
What are the key properties of (2E)-2-hydroxyimino-3,4-dihydronaphthalen-1-one?
(2E)-2-hydroxyimino-3,4-dihydronaphthalen-1-one has a molecular weight of 175.19 g/mol, XLogP of 1.65, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-hydroxyimino-3,4-dihydronaphthalen-1-one is sourced from PubChem (CID 6413926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).