C22H18BrN7OS2 — CID 6414363
2-[(8-bromo-5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[5-(4-methylphenyl)-4H-1,3,4-thiadiazin-2-yl]acetamide (PubChem CID 6414363) has the molecular formula C22H18BrN7OS2 and a molecular weight of 540.47 g/mol. Its IUPAC name is 2-[(8-bromo-5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[5-(4-methylphenyl)-4H-1,3,4-thiadiazin-2-yl]acetamide.
| Compound Name | 2-[(8-bromo-5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[5-(4-methylphenyl)-4H-1,3,4-thiadiazin-2-yl]acetamide |
|---|---|
| PubChem CID | 6414363 |
| Molecular Formula | C22H18BrN7OS2 |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 539.02 |
| IUPAC Name | 2-[(8-bromo-5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[5-(4-methylphenyl)-4H-1,3,4-thiadiazin-2-yl]acetamide |
| SMILES | Cc1ccc(C2=CSC(NC(=O)CSc3nnc4c5cc(Br)ccc5n(C)c4n3)=NN2)cc1 |
| InChI | InChI=1S/C22H18BrN7OS2/c1-12-3-5-13(6-4-12)16-10-32-21(28-26-16)24-18(31)11-33-22-25-20-19(27-29-22)15-9-14(23)7-8-17(15)30(20)2/h3-10,26H,11H2,1-2H3,(H,24,28,31) |
| InChIKey | PXRXOXWUAXXCDW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 97.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |