About 3,4-dibromofuran
3,4-dibromofuran (PubChem CID 641482) has the molecular formula C4H2Br2O
and a molecular weight of 225.87 g/mol. Its IUPAC name is 3,4-dibromofuran.
Molecular Properties
| Compound Name | 3,4-dibromofuran |
| PubChem CID | 641482 |
| Molecular Formula | C4H2Br2O |
| Molecular Weight | 225.87 g/mol |
| Exact Mass | 223.85 |
| IUPAC Name | 3,4-dibromofuran |
| SMILES | Brc1cocc1Br |
| InChI | InChI=1S/C4H2Br2O/c5-3-1-7-2-4(3)6/h1-2H |
| InChIKey | ZBNAIRILIJMDEE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.87 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dibromofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dibromofuran?
The IUPAC name of 3,4-dibromofuran (CID 641482) is 3,4-dibromofuran.
What is the SMILES notation for 3,4-dibromofuran?
The canonical SMILES for 3,4-dibromofuran is Brc1cocc1Br.
What is the InChIKey of 3,4-dibromofuran?
The InChIKey is ZBNAIRILIJMDEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2Br2O/c5-3-1-7-2-4(3)6/h1-2H.
What are the key properties of 3,4-dibromofuran?
3,4-dibromofuran has a molecular weight of 225.87 g/mol, XLogP of 2.80, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dibromofuran is sourced from PubChem (CID 641482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).