About (3-methyl-1,3-oxazolidin-2-ylidene)cyanamide
(3-methyl-1,3-oxazolidin-2-ylidene)cyanamide (PubChem CID 641538) has the molecular formula C5H7N3O
and a molecular weight of 125.13 g/mol. Its IUPAC name is (3-methyl-1,3-oxazolidin-2-ylidene)cyanamide.
Molecular Properties
| Compound Name | (3-methyl-1,3-oxazolidin-2-ylidene)cyanamide |
| PubChem CID | 641538 |
| Molecular Formula | C5H7N3O |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.06 |
| IUPAC Name | (3-methyl-1,3-oxazolidin-2-ylidene)cyanamide |
| SMILES | CN1CCO/C1=N\C#N |
| InChI | InChI=1S/C5H7N3O/c1-8-2-3-9-5(8)7-4-6/h2-3H2,1H3/b7-5- |
| InChIKey | RKJISTFLGTVDHY-ALCCZGGFSA-N |
| XLogP | -0.21 |
| TPSA | 48.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-1,3-oxazolidin-2-ylidene)cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-1,3-oxazolidin-2-ylidene)cyanamide?
The IUPAC name of (3-methyl-1,3-oxazolidin-2-ylidene)cyanamide (CID 641538) is (3-methyl-1,3-oxazolidin-2-ylidene)cyanamide.
What is the SMILES notation for (3-methyl-1,3-oxazolidin-2-ylidene)cyanamide?
The canonical SMILES for (3-methyl-1,3-oxazolidin-2-ylidene)cyanamide is CN1CCO/C1=N\C#N.
What is the InChIKey of (3-methyl-1,3-oxazolidin-2-ylidene)cyanamide?
The InChIKey is RKJISTFLGTVDHY-ALCCZGGFSA-N. The full InChI is InChI=1S/C5H7N3O/c1-8-2-3-9-5(8)7-4-6/h2-3H2,1H3/b7-5-.
What are the key properties of (3-methyl-1,3-oxazolidin-2-ylidene)cyanamide?
(3-methyl-1,3-oxazolidin-2-ylidene)cyanamide has a molecular weight of 125.13 g/mol, XLogP of -0.21, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-1,3-oxazolidin-2-ylidene)cyanamide is sourced from PubChem (CID 641538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).