About 3-methyl-5-nitro-1,3-benzoxazol-2-one
3-methyl-5-nitro-1,3-benzoxazol-2-one (PubChem CID 641557) has the molecular formula C8H6N2O4
and a molecular weight of 194.15 g/mol. Its IUPAC name is 3-methyl-5-nitro-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 3-methyl-5-nitro-1,3-benzoxazol-2-one |
| PubChem CID | 641557 |
| Molecular Formula | C8H6N2O4 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 3-methyl-5-nitro-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C8H6N2O4/c1-9-6-4-5(10(12)13)2-3-7(6)14-8(9)11/h2-4H,1H3 |
| InChIKey | NEUIGIUWAYOYAM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 78.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-5-nitro-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-nitro-1,3-benzoxazol-2-one?
The IUPAC name of 3-methyl-5-nitro-1,3-benzoxazol-2-one (CID 641557) is 3-methyl-5-nitro-1,3-benzoxazol-2-one.
What is the SMILES notation for 3-methyl-5-nitro-1,3-benzoxazol-2-one?
The canonical SMILES for 3-methyl-5-nitro-1,3-benzoxazol-2-one is Cn1c(=O)oc2ccc([N+](=O)[O-])cc21.
What is the InChIKey of 3-methyl-5-nitro-1,3-benzoxazol-2-one?
The InChIKey is NEUIGIUWAYOYAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O4/c1-9-6-4-5(10(12)13)2-3-7(6)14-8(9)11/h2-4H,1H3.
What are the key properties of 3-methyl-5-nitro-1,3-benzoxazol-2-one?
3-methyl-5-nitro-1,3-benzoxazol-2-one has a molecular weight of 194.15 g/mol, XLogP of 1.04, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-nitro-1,3-benzoxazol-2-one is sourced from PubChem (CID 641557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).