C29H28N4O2S — CID 6416088
6-(4-cyclopentyloxyphenyl)-3-[(4-methylphenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 6416088) has the molecular formula C29H28N4O2S and a molecular weight of 496.64 g/mol. Its IUPAC name is 6-(4-cyclopentyloxyphenyl)-3-[(4-methylphenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | 6-(4-cyclopentyloxyphenyl)-3-[(4-methylphenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 6416088 |
| Molecular Formula | C29H28N4O2S |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 6-(4-cyclopentyloxyphenyl)-3-[(4-methylphenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | Cc1ccc(CSc2nnc3c(n2)OC(c2ccc(OC4CCCC4)cc2)Nc2ccccc2-3)cc1 |
| InChI | InChI=1S/C29H28N4O2S/c1-19-10-12-20(13-11-19)18-36-29-31-28-26(32-33-29)24-8-4-5-9-25(24)30-27(35-28)21-14-16-23(17-15-21)34-22-6-2-3-7-22/h4-5,8-17,22,27,30H,2-3,6-7,18H2,1H3 |
| InChIKey | NKFZWYVTPUDQGN-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |