About (4E,6E)-1-(4-hydroxyphenyl)-7-phenylhepta-4,6-dien-3-one
(4E,6E)-1-(4-hydroxyphenyl)-7-phenylhepta-4,6-dien-3-one (PubChem CID 641618) has the molecular formula C19H18O2
and a molecular weight of 278.35 g/mol. Its IUPAC name is (4E,6E)-1-(4-hydroxyphenyl)-7-phenylhepta-4,6-dien-3-one.
Molecular Properties
| Compound Name | (4E,6E)-1-(4-hydroxyphenyl)-7-phenylhepta-4,6-dien-3-one |
| PubChem CID | 641618 |
| Molecular Formula | C19H18O2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (4E,6E)-1-(4-hydroxyphenyl)-7-phenylhepta-4,6-dien-3-one |
| SMILES | O=C(/C=C/C=C/c1ccccc1)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C19H18O2/c20-18(13-10-17-11-14-19(21)15-12-17)9-5-4-8-16-6-2-1-3-7-16/h1-9,11-12,14-15,21H,10,13H2/b8-4+,9-5+ |
| InChIKey | GIXGHUAQPPUMRA-KBXRYBNXSA-N |
| XLogP | 4.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E,6E)-1-(4-hydroxyphenyl)-7-phenylhepta-4,6-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,6E)-1-(4-hydroxyphenyl)-7-phenylhepta-4,6-dien-3-one?
The IUPAC name of (4E,6E)-1-(4-hydroxyphenyl)-7-phenylhepta-4,6-dien-3-one (CID 641618) is (4E,6E)-1-(4-hydroxyphenyl)-7-phenylhepta-4,6-dien-3-one.
What is the SMILES notation for (4E,6E)-1-(4-hydroxyphenyl)-7-phenylhepta-4,6-dien-3-one?
The canonical SMILES for (4E,6E)-1-(4-hydroxyphenyl)-7-phenylhepta-4,6-dien-3-one is O=C(/C=C/C=C/c1ccccc1)CCc1ccc(O)cc1.
What is the InChIKey of (4E,6E)-1-(4-hydroxyphenyl)-7-phenylhepta-4,6-dien-3-one?
The InChIKey is GIXGHUAQPPUMRA-KBXRYBNXSA-N. The full InChI is InChI=1S/C19H18O2/c20-18(13-10-17-11-14-19(21)15-12-17)9-5-4-8-16-6-2-1-3-7-16/h1-9,11-12,14-15,21H,10,13H2/b8-4+,9-5+.
What are the key properties of (4E,6E)-1-(4-hydroxyphenyl)-7-phenylhepta-4,6-dien-3-one?
(4E,6E)-1-(4-hydroxyphenyl)-7-phenylhepta-4,6-dien-3-one has a molecular weight of 278.35 g/mol, XLogP of 4.16, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,6E)-1-(4-hydroxyphenyl)-7-phenylhepta-4,6-dien-3-one is sourced from PubChem (CID 641618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).