C24H15Br2N5O5S — CID 6416244
[2,6-dibromo-4-(3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenyl] 4-nitrobenzoate (PubChem CID 6416244) has the molecular formula C24H15Br2N5O5S and a molecular weight of 645.29 g/mol. Its IUPAC name is [2,6-dibromo-4-(3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenyl] 4-nitrobenzoate.
| Compound Name | [2,6-dibromo-4-(3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 6416244 |
| Molecular Formula | C24H15Br2N5O5S |
| Molecular Weight | 645.29 g/mol |
| Exact Mass | 642.92 |
| IUPAC Name | [2,6-dibromo-4-(3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenyl] 4-nitrobenzoate |
| SMILES | CSc1nnc2c(n1)OC(c1cc(Br)c(OC(=O)c3ccc([N+](=O)[O-])cc3)c(Br)c1)Nc1ccccc1-2 |
| InChI | InChI=1S/C24H15Br2N5O5S/c1-37-24-28-22-19(29-30-24)15-4-2-3-5-18(15)27-21(36-22)13-10-16(25)20(17(26)11-13)35-23(32)12-6-8-14(9-7-12)31(33)34/h2-11,21,27H,1H3 |
| InChIKey | RJTRBJMUNAJNLN-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 129.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.29 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|