About [(1E,3E)-4-phenylbuta-1,3-dienyl]benzene
[(1E,3E)-4-phenylbuta-1,3-dienyl]benzene (PubChem CID 641683) has the molecular formula C16H14
and a molecular weight of 206.29 g/mol. Its IUPAC name is [(1E,3E)-4-phenylbuta-1,3-dienyl]benzene.
Molecular Properties
| Compound Name | [(1E,3E)-4-phenylbuta-1,3-dienyl]benzene |
| PubChem CID | 641683 |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | [(1E,3E)-4-phenylbuta-1,3-dienyl]benzene |
| SMILES | C(/C=C/c1ccccc1)=C\c1ccccc1 |
| InChI | InChI=1S/C16H14/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16/h1-14H/b13-7+,14-8+ |
| InChIKey | JFLKFZNIIQFQBS-FNCQTZNRSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1E,3E)-4-phenylbuta-1,3-dienyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E,3E)-4-phenylbuta-1,3-dienyl]benzene?
The IUPAC name of [(1E,3E)-4-phenylbuta-1,3-dienyl]benzene (CID 641683) is [(1E,3E)-4-phenylbuta-1,3-dienyl]benzene.
What is the SMILES notation for [(1E,3E)-4-phenylbuta-1,3-dienyl]benzene?
The canonical SMILES for [(1E,3E)-4-phenylbuta-1,3-dienyl]benzene is C(/C=C/c1ccccc1)=C\c1ccccc1.
What is the InChIKey of [(1E,3E)-4-phenylbuta-1,3-dienyl]benzene?
The InChIKey is JFLKFZNIIQFQBS-FNCQTZNRSA-N. The full InChI is InChI=1S/C16H14/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16/h1-14H/b13-7+,14-8+.
What are the key properties of [(1E,3E)-4-phenylbuta-1,3-dienyl]benzene?
[(1E,3E)-4-phenylbuta-1,3-dienyl]benzene has a molecular weight of 206.29 g/mol, XLogP of 4.41, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E,3E)-4-phenylbuta-1,3-dienyl]benzene is sourced from PubChem (CID 641683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).