C20H21N5O — CID 6416946
N-(5H-[1,2,4]triazino[5,6-b]indol-3-yl)adamantane-1-carboxamide (PubChem CID 6416946) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is N-(5H-[1,2,4]triazino[5,6-b]indol-3-yl)adamantane-1-carboxamide.
| Compound Name | N-(5H-[1,2,4]triazino[5,6-b]indol-3-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 6416946 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-(5H-[1,2,4]triazino[5,6-b]indol-3-yl)adamantane-1-carboxamide |
| SMILES | O=C(Nc1nnc2c(n1)[nH]c1ccccc12)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H21N5O/c26-18(20-8-11-5-12(9-20)7-13(6-11)10-20)23-19-22-17-16(24-25-19)14-3-1-2-4-15(14)21-17/h1-4,11-13H,5-10H2,(H2,21,22,23,25,26) |
| InChIKey | IKIMDSIDSXXWNI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |