C29H32O4 — CID 641711
5-(7,7-dimethylfuro[2,3-f]chromen-2-yl)-4,6-bis(3-methylbut-2-enyl)benzene-1,3-diol (PubChem CID 641711) has the molecular formula C29H32O4 and a molecular weight of 444.57 g/mol. Its IUPAC name is 5-(7,7-dimethylfuro[2,3-f]chromen-2-yl)-4,6-bis(3-methylbut-2-enyl)benzene-1,3-diol.
| Compound Name | 5-(7,7-dimethylfuro[2,3-f]chromen-2-yl)-4,6-bis(3-methylbut-2-enyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 641711 |
| Molecular Formula | C29H32O4 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 5-(7,7-dimethylfuro[2,3-f]chromen-2-yl)-4,6-bis(3-methylbut-2-enyl)benzene-1,3-diol |
| SMILES | CC(C)=CCc1c(O)cc(O)c(CC=C(C)C)c1-c1cc2ccc3c(c2o1)C=CC(C)(C)O3 |
| InChI | InChI=1S/C29H32O4/c1-17(2)7-10-20-23(30)16-24(31)21(11-8-18(3)4)27(20)26-15-19-9-12-25-22(28(19)32-26)13-14-29(5,6)33-25/h7-9,12-16,30-31H,10-11H2,1-6H3 |
| InChIKey | LNBFFYUGHCUNLA-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|