C24H19N5O2 — CID 6417136
N-(5-benzyl-8-methoxy-[1,2,4]triazino[5,6-b]indol-3-yl)benzamide (PubChem CID 6417136) has the molecular formula C24H19N5O2 and a molecular weight of 409.45 g/mol. Its IUPAC name is N-(5-benzyl-8-methoxy-[1,2,4]triazino[5,6-b]indol-3-yl)benzamide.
| Compound Name | N-(5-benzyl-8-methoxy-[1,2,4]triazino[5,6-b]indol-3-yl)benzamide |
|---|---|
| PubChem CID | 6417136 |
| Molecular Formula | C24H19N5O2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-(5-benzyl-8-methoxy-[1,2,4]triazino[5,6-b]indol-3-yl)benzamide |
| SMILES | COc1ccc2c(c1)c1nnc(NC(=O)c3ccccc3)nc1n2Cc1ccccc1 |
| InChI | InChI=1S/C24H19N5O2/c1-31-18-12-13-20-19(14-18)21-22(29(20)15-16-8-4-2-5-9-16)25-24(28-27-21)26-23(30)17-10-6-3-7-11-17/h2-14H,15H2,1H3,(H,25,26,28,30) |
| InChIKey | LBZCWBQADXPLHF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |