C26H26N2 — CID 641752
5-[(E)-2-[(1S,2R)-2-(1H-indol-5-yl)-1,4-dimethylcyclohex-3-en-1-yl]ethenyl]-1H-indole (PubChem CID 641752) has the molecular formula C26H26N2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 5-[(E)-2-[(1S,2R)-2-(1H-indol-5-yl)-1,4-dimethylcyclohex-3-en-1-yl]ethenyl]-1H-indole.
| Compound Name | 5-[(E)-2-[(1S,2R)-2-(1H-indol-5-yl)-1,4-dimethylcyclohex-3-en-1-yl]ethenyl]-1H-indole |
|---|---|
| PubChem CID | 641752 |
| Molecular Formula | C26H26N2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 5-[(E)-2-[(1S,2R)-2-(1H-indol-5-yl)-1,4-dimethylcyclohex-3-en-1-yl]ethenyl]-1H-indole |
| SMILES | CC1=C[C@@H](c2ccc3[nH]ccc3c2)[C@](C)(/C=C/c2ccc3[nH]ccc3c2)CC1 |
| InChI | InChI=1S/C26H26N2/c1-18-7-11-26(2,12-8-19-3-5-24-21(16-19)9-13-27-24)23(15-18)20-4-6-25-22(17-20)10-14-28-25/h3-6,8-10,12-17,23,27-28H,7,11H2,1-2H3/b12-8+/t23-,26-/m0/s1 |
| InChIKey | AGXPNMMYDKKSMT-FSYXRNBESA-N |
| XLogP | 7.19 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|