C28H20N8O4 — CID 6417528
1-[2-[[1,1-dicyano-3-(4-nitrophenoxy)prop-1-en-2-yl]amino]phenyl]-3-(6-phenylpyridazin-3-yl)urea (PubChem CID 6417528) has the molecular formula C28H20N8O4 and a molecular weight of 532.52 g/mol. Its IUPAC name is 1-[2-[[1,1-dicyano-3-(4-nitrophenoxy)prop-1-en-2-yl]amino]phenyl]-3-(6-phenylpyridazin-3-yl)urea.
| Compound Name | 1-[2-[[1,1-dicyano-3-(4-nitrophenoxy)prop-1-en-2-yl]amino]phenyl]-3-(6-phenylpyridazin-3-yl)urea |
|---|---|
| PubChem CID | 6417528 |
| Molecular Formula | C28H20N8O4 |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 1-[2-[[1,1-dicyano-3-(4-nitrophenoxy)prop-1-en-2-yl]amino]phenyl]-3-(6-phenylpyridazin-3-yl)urea |
| SMILES | N#CC(C#N)=C(COc1ccc([N+](=O)[O-])cc1)Nc1ccccc1NC(=O)Nc1ccc(-c2ccccc2)nn1 |
| InChI | InChI=1S/C28H20N8O4/c29-16-20(17-30)26(18-40-22-12-10-21(11-13-22)36(38)39)31-24-8-4-5-9-25(24)32-28(37)33-27-15-14-23(34-35-27)19-6-2-1-3-7-19/h1-15,31H,18H2,(H2,32,33,35,37) |
| InChIKey | YFOBPOPVVKFUPX-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 178.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|