About (2S,5S)-2,5-dimethylmorpholine
(2S,5S)-2,5-dimethylmorpholine (PubChem CID 641781) has the molecular formula C6H13NO
and a molecular weight of 115.18 g/mol. Its IUPAC name is (2S,5S)-2,5-dimethylmorpholine.
Molecular Properties
| Compound Name | (2S,5S)-2,5-dimethylmorpholine |
| PubChem CID | 641781 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | (2S,5S)-2,5-dimethylmorpholine |
| SMILES | C[C@H]1CO[C@@H](C)CN1 |
| InChI | InChI=1S/C6H13NO/c1-5-4-8-6(2)3-7-5/h5-7H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | RPSYMAMREDJAES-WDSKDSINSA-N |
| XLogP | 0.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,5S)-2,5-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5S)-2,5-dimethylmorpholine?
The IUPAC name of (2S,5S)-2,5-dimethylmorpholine (CID 641781) is (2S,5S)-2,5-dimethylmorpholine.
What is the SMILES notation for (2S,5S)-2,5-dimethylmorpholine?
The canonical SMILES for (2S,5S)-2,5-dimethylmorpholine is C[C@H]1CO[C@@H](C)CN1.
What is the InChIKey of (2S,5S)-2,5-dimethylmorpholine?
The InChIKey is RPSYMAMREDJAES-WDSKDSINSA-N. The full InChI is InChI=1S/C6H13NO/c1-5-4-8-6(2)3-7-5/h5-7H,3-4H2,1-2H3/t5-,6-/m0/s1.
What are the key properties of (2S,5S)-2,5-dimethylmorpholine?
(2S,5S)-2,5-dimethylmorpholine has a molecular weight of 115.18 g/mol, XLogP of 0.38, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5S)-2,5-dimethylmorpholine is sourced from PubChem (CID 641781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).