About 4-[5-(2,5-dichlorophenyl)furan-2-yl]-3,6-diphenylpyridazine
4-[5-(2,5-dichlorophenyl)furan-2-yl]-3,6-diphenylpyridazine (PubChem CID 6418102) has the molecular formula C26H16Cl2N2O
and a molecular weight of 443.33 g/mol. Its IUPAC name is 4-[5-(2,5-dichlorophenyl)furan-2-yl]-3,6-diphenylpyridazine.
Molecular Properties
| Compound Name | 4-[5-(2,5-dichlorophenyl)furan-2-yl]-3,6-diphenylpyridazine |
| PubChem CID | 6418102 |
| Molecular Formula | C26H16Cl2N2O |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 4-[5-(2,5-dichlorophenyl)furan-2-yl]-3,6-diphenylpyridazine |
| SMILES | Clc1ccc(Cl)c(-c2ccc(-c3cc(-c4ccccc4)nnc3-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C26H16Cl2N2O/c27-19-11-12-22(28)20(15-19)24-13-14-25(31-24)21-16-23(17-7-3-1-4-8-17)29-30-26(21)18-9-5-2-6-10-18/h1-16H |
| InChIKey | ICDPMJUXXHNDRY-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[5-(2,5-dichlorophenyl)furan-2-yl]-3,6-diphenylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(2,5-dichlorophenyl)furan-2-yl]-3,6-diphenylpyridazine?
The IUPAC name of 4-[5-(2,5-dichlorophenyl)furan-2-yl]-3,6-diphenylpyridazine (CID 6418102) is 4-[5-(2,5-dichlorophenyl)furan-2-yl]-3,6-diphenylpyridazine.
What is the SMILES notation for 4-[5-(2,5-dichlorophenyl)furan-2-yl]-3,6-diphenylpyridazine?
The canonical SMILES for 4-[5-(2,5-dichlorophenyl)furan-2-yl]-3,6-diphenylpyridazine is Clc1ccc(Cl)c(-c2ccc(-c3cc(-c4ccccc4)nnc3-c3ccccc3)o2)c1.
What is the InChIKey of 4-[5-(2,5-dichlorophenyl)furan-2-yl]-3,6-diphenylpyridazine?
The InChIKey is ICDPMJUXXHNDRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H16Cl2N2O/c27-19-11-12-22(28)20(15-19)24-13-14-25(31-24)21-16-23(17-7-3-1-4-8-17)29-30-26(21)18-9-5-2-6-10-18/h1-16H.
What are the key properties of 4-[5-(2,5-dichlorophenyl)furan-2-yl]-3,6-diphenylpyridazine?
4-[5-(2,5-dichlorophenyl)furan-2-yl]-3,6-diphenylpyridazine has a molecular weight of 443.33 g/mol, XLogP of 8.04, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(2,5-dichlorophenyl)furan-2-yl]-3,6-diphenylpyridazine is sourced from PubChem (CID 6418102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).