C16H11N5O3S2 — CID 6418149
2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 6418149) has the molecular formula C16H11N5O3S2 and a molecular weight of 385.43 g/mol. Its IUPAC name is 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 6418149 |
| Molecular Formula | C16H11N5O3S2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CSc1nnc(-c2ccco2)c(-c2ccco2)n1)Nc1nccs1 |
| InChI | InChI=1S/C16H11N5O3S2/c22-12(18-15-17-5-8-25-15)9-26-16-19-13(10-3-1-6-23-10)14(20-21-16)11-4-2-7-24-11/h1-8H,9H2,(H,17,18,22) |
| InChIKey | YUSALVLEEUNYJH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_thio_6_furan(4)', 'substructure': 'N/A'} |
|---|