C18H17BrN4OS2 — CID 6418245
6-(5-bromothiophen-2-yl)-3-butylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 6418245) has the molecular formula C18H17BrN4OS2 and a molecular weight of 449.40 g/mol. Its IUPAC name is 6-(5-bromothiophen-2-yl)-3-butylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | 6-(5-bromothiophen-2-yl)-3-butylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 6418245 |
| Molecular Formula | C18H17BrN4OS2 |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 448.00 |
| IUPAC Name | 6-(5-bromothiophen-2-yl)-3-butylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | CCCCSc1nnc2c(n1)OC(c1ccc(Br)s1)Nc1ccccc1-2 |
| InChI | InChI=1S/C18H17BrN4OS2/c1-2-3-10-25-18-21-17-15(22-23-18)11-6-4-5-7-12(11)20-16(24-17)13-8-9-14(19)26-13/h4-9,16,20H,2-3,10H2,1H3 |
| InChIKey | CTQNVYBBMHPCFL-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|