C23H24F2N4OS — CID 6418340
2-[[5,6-bis(3-fluorophenyl)-1,2,4-triazin-3-yl]sulfanyl]-N-butylbutanamide (PubChem CID 6418340) has the molecular formula C23H24F2N4OS and a molecular weight of 442.54 g/mol. Its IUPAC name is 2-[[5,6-bis(3-fluorophenyl)-1,2,4-triazin-3-yl]sulfanyl]-N-butylbutanamide.
| Compound Name | 2-[[5,6-bis(3-fluorophenyl)-1,2,4-triazin-3-yl]sulfanyl]-N-butylbutanamide |
|---|---|
| PubChem CID | 6418340 |
| Molecular Formula | C23H24F2N4OS |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2-[[5,6-bis(3-fluorophenyl)-1,2,4-triazin-3-yl]sulfanyl]-N-butylbutanamide |
| SMILES | CCCCNC(=O)C(CC)Sc1nnc(-c2cccc(F)c2)c(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C23H24F2N4OS/c1-3-5-12-26-22(30)19(4-2)31-23-27-20(15-8-6-10-17(24)13-15)21(28-29-23)16-9-7-11-18(25)14-16/h6-11,13-14,19H,3-5,12H2,1-2H3,(H,26,30) |
| InChIKey | GSBZSXNFPVMIHO-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|