C23H18ClN3OS — CID 6418668
3-[2-(2-chlorophenoxy)ethylsulfanyl]-5,6-diphenyl-1,2,4-triazine (PubChem CID 6418668) has the molecular formula C23H18ClN3OS and a molecular weight of 419.94 g/mol. Its IUPAC name is 3-[2-(2-chlorophenoxy)ethylsulfanyl]-5,6-diphenyl-1,2,4-triazine.
| Compound Name | 3-[2-(2-chlorophenoxy)ethylsulfanyl]-5,6-diphenyl-1,2,4-triazine |
|---|---|
| PubChem CID | 6418668 |
| Molecular Formula | C23H18ClN3OS |
| Molecular Weight | 419.94 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 3-[2-(2-chlorophenoxy)ethylsulfanyl]-5,6-diphenyl-1,2,4-triazine |
| SMILES | Clc1ccccc1OCCSc1nnc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H18ClN3OS/c24-19-13-7-8-14-20(19)28-15-16-29-23-25-21(17-9-3-1-4-10-17)22(26-27-23)18-11-5-2-6-12-18/h1-14H,15-16H2 |
| InChIKey | GTWMNUWGALPNAV-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.94 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|