About 3-chloro-6-[(2,4-dichlorophenyl)methyl]pyridazine
3-chloro-6-[(2,4-dichlorophenyl)methyl]pyridazine (PubChem CID 6418723) has the molecular formula C11H7Cl3N2
and a molecular weight of 273.55 g/mol. Its IUPAC name is 3-chloro-6-[(2,4-dichlorophenyl)methyl]pyridazine.
Molecular Properties
| Compound Name | 3-chloro-6-[(2,4-dichlorophenyl)methyl]pyridazine |
| PubChem CID | 6418723 |
| Molecular Formula | C11H7Cl3N2 |
| Molecular Weight | 273.55 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | 3-chloro-6-[(2,4-dichlorophenyl)methyl]pyridazine |
| SMILES | Clc1ccc(Cc2ccc(Cl)nn2)c(Cl)c1 |
| InChI | InChI=1S/C11H7Cl3N2/c12-8-2-1-7(10(13)6-8)5-9-3-4-11(14)16-15-9/h1-4,6H,5H2 |
| InChIKey | SIKKNLLCEHLQMS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-6-[(2,4-dichlorophenyl)methyl]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-6-[(2,4-dichlorophenyl)methyl]pyridazine?
The IUPAC name of 3-chloro-6-[(2,4-dichlorophenyl)methyl]pyridazine (CID 6418723) is 3-chloro-6-[(2,4-dichlorophenyl)methyl]pyridazine.
What is the SMILES notation for 3-chloro-6-[(2,4-dichlorophenyl)methyl]pyridazine?
The canonical SMILES for 3-chloro-6-[(2,4-dichlorophenyl)methyl]pyridazine is Clc1ccc(Cc2ccc(Cl)nn2)c(Cl)c1.
What is the InChIKey of 3-chloro-6-[(2,4-dichlorophenyl)methyl]pyridazine?
The InChIKey is SIKKNLLCEHLQMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7Cl3N2/c12-8-2-1-7(10(13)6-8)5-9-3-4-11(14)16-15-9/h1-4,6H,5H2.
What are the key properties of 3-chloro-6-[(2,4-dichlorophenyl)methyl]pyridazine?
3-chloro-6-[(2,4-dichlorophenyl)methyl]pyridazine has a molecular weight of 273.55 g/mol, XLogP of 4.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-6-[(2,4-dichlorophenyl)methyl]pyridazine is sourced from PubChem (CID 6418723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).